CAS 3526-42-9 appears in our catalog under these names: N-(2H-1,3-Benzodioxol-5-ylmethyl)aniline, 95%, N-(1,3-Dioxaindan-5-ylmethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
N-(1,3-benzodioxol-5-ylmethyl)aniline (CAS 3526-42-9) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)aniline. InChIKey: YFPTUQPYCPKYRU-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)aniline |
| InChIKey | YFPTUQPYCPKYRU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC3=CC=CC=C3 |
Computed by PubChem (NCBI)