CAS 35296-56-1 appears in our catalog under these names: 4-O-Methyl Levodopa, Levodopa Impurity 11, 3-Hydroxy-O-methyl-L-tyrosine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2S)-2-amino-3-(3-hydroxy-4-methoxyphenyl)propanoic acid (CAS 35296-56-1) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: (2S)-2-amino-3-(3-hydroxy-4-methoxyphenyl)propanoic acid. InChIKey: QRXPIKKZQGWJMW-ZETCQYMHSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-hydroxy-4-methoxyphenyl)propanoic acid |
| InChIKey | QRXPIKKZQGWJMW-ZETCQYMHSA-N |
| SMILES | COC1=C(C=C(C=C1)C[C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)