CAS 2855-92-7 is the registry number for 4,6-Dimethoxy-2'-methyl-3,4',6'-grisantrione. Offered by: TRC. Available pack sizes: 10mg.
4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexane]-1',3,3'-trione (CAS 2855-92-7) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: 4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexane]-1',3,3'-trione. InChIKey: WHASGVKEKOYBSQ-UHFFFAOYSA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | 4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexane]-1',3,3'-trione |
| InChIKey | WHASGVKEKOYBSQ-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)CC(=O)C12C(=O)C3=C(O2)C=C(C=C3OC)OC |
Computed by PubChem (NCBI)