Products 35372-39-5
CAS 35372-39-5 is the registry number for N-(2,3-Dichlorophenyl)acetimidamide, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N'-(2,3-dichlorophenyl)ethanimidamide (CAS 35372-39-5) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: N'-(2,3-dichlorophenyl)ethanimidamide. InChIKey: YZVNHDOZTGCCEE-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | N'-(2,3-dichlorophenyl)ethanimidamide |
| InChIKey | YZVNHDOZTGCCEE-UHFFFAOYSA-N |
| SMILES | CC(=NC1=C(C(=CC=C1)Cl)Cl)N |
Computed by PubChem (NCBI)