CAS 353786-74-0 appears in our catalog under these names: 6,8-Dimethyl-5h-[1,2,4]triazino[5,6-b]indole-3-thiol, 95%, 6,8-Dimethyl-5H-(1,2,4)triazino(5,6-b)indole-3-thiol, 90%, 6,8-dimethyl-1,2,4-triazino(5,6-b)indole-3-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g.
6,8-dimethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione (CAS 353786-74-0) is a chemical compound with the molecular formula C11H10N4S and a molecular weight of 230.29 g/mol. IUPAC name: 6,8-dimethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione. InChIKey: VZKXOKIJXOPLJD-UHFFFAOYSA-N.
| Molecular formula | C11H10N4S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 6,8-dimethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
| InChIKey | VZKXOKIJXOPLJD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C3=NNC(=S)N=C3N2)C |
Computed by PubChem (NCBI)