CAS 868387-59-1 appears in our catalog under these names: 5-Methyl-4-{1H-pyrrolo(2,3-b)pyridin-3-yl}-1,3-thiazol-2-amine, 95%, 5-Methyl-4-{1H-pyrrolo(2,3-b)pyridin-3-yl}-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-methyl-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-amine (CAS 868387-59-1) is a chemical compound with the molecular formula C11H10N4S and a molecular weight of 230.29 g/mol. IUPAC name: 5-methyl-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-amine. InChIKey: RAIOGCMRVIFDFU-UHFFFAOYSA-N.
| Molecular formula | C11H10N4S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 5-methyl-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-amine |
| InChIKey | RAIOGCMRVIFDFU-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)N)C2=CNC3=C2C=CC=N3 |
Computed by PubChem (NCBI)