CAS 354548-36-0 appears in our catalog under these names: 8-Ethyl-2,5-dihydro-3h-[1,2,4]triazino[5,6-b]indole-3-thione, 95%, 8-EThyl-2,5-dihydro-3h-(1,2,4)triazino(5,6-b)indole-3-thione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
8-ethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione (CAS 354548-36-0) is a chemical compound with the molecular formula C11H10N4S and a molecular weight of 230.29 g/mol. IUPAC name: 8-ethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione. InChIKey: IGWALTZGBYKKEF-UHFFFAOYSA-N.
| Molecular formula | C11H10N4S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 8-ethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
| InChIKey | IGWALTZGBYKKEF-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NC3=NC(=S)NN=C23 |
Computed by PubChem (NCBI)