CAS 885521-91-5 is the registry number for 5-(1-Methyl-1H-indol-3-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1-methylindol-3-yl)-1,3,4-thiadiazol-2-amine (CAS 885521-91-5) is a chemical compound with the molecular formula C11H10N4S and a molecular weight of 230.29 g/mol. IUPAC name: 5-(1-methylindol-3-yl)-1,3,4-thiadiazol-2-amine. InChIKey: NIXXMFLOHPCPTK-UHFFFAOYSA-N.
| Molecular formula | C11H10N4S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 5-(1-methylindol-3-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | NIXXMFLOHPCPTK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NN=C(S3)N |
Computed by PubChem (NCBI)