CAS 35423-09-7 is the registry number for Tesimide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4Z)-4-benzylidene-5,6,7,8-tetrahydroisoquinoline-1,3-dione (CAS 35423-09-7) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: (4Z)-4-benzylidene-5,6,7,8-tetrahydroisoquinoline-1,3-dione. InChIKey: JFTOCKFCHJCDDX-UVTDQMKNSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | (4Z)-4-benzylidene-5,6,7,8-tetrahydroisoquinoline-1,3-dione |
| InChIKey | JFTOCKFCHJCDDX-UVTDQMKNSA-N |
| SMILES | C1CCC2=C(C1)/C(=C/C3=CC=CC=C3)/C(=O)NC2=O |
Computed by PubChem (NCBI)