CAS 355135-40-9 appears in our catalog under these names: 7-Bromo-2-hydroxy-4h-pyrido[1,2-a]pyrimidin-4-one, 95%, 7-Bromo-2-hydroxy-4H-pyrido(1,2-a)pyrimidin-4-one, 97%, 7-Bromo-2-hydroxy-4H-pyrido(1,2-a)pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 1g, 2,5g.
7-bromo-2-hydroxypyrido[1,2-a]pyrimidin-4-one (CAS 355135-40-9) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromo-2-hydroxypyrido[1,2-a]pyrimidin-4-one. InChIKey: SVGJFNCVLKQSPN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromo-2-hydroxypyrido[1,2-a]pyrimidin-4-one |
| InChIKey | SVGJFNCVLKQSPN-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1Br)O |
Computed by PubChem (NCBI)