Products 35515-31-2
CAS 35515-31-2 appears in our catalog under these names: 1-(2-Chloro-4-methylsulfanyl-phenyl)-ethanone, 95%, 1-(2-Chloro-4-(methylsulfanyl)phenyl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 5g, 250mg, 10g, 1g, 2,5g.
1-(2-chloro-4-methylsulfanylphenyl)ethanone (CAS 35515-31-2) is a chemical compound with the molecular formula C9H9ClOS and a molecular weight of 200.69 g/mol. IUPAC name: 1-(2-chloro-4-methylsulfanylphenyl)ethanone. InChIKey: YZLNUKOPZVCGKW-UHFFFAOYSA-N.
| Molecular formula | C9H9ClOS |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | 1-(2-chloro-4-methylsulfanylphenyl)ethanone |
| InChIKey | YZLNUKOPZVCGKW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)SC)Cl |
Computed by PubChem (NCBI)