CAS 65361-26-4 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1-benzothiophene-2-carbonyl chloride, 95%, 4,5,6,7-Tetrahydrobenzo(b)thiophene-2-carbonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride (CAS 65361-26-4) is a chemical compound with the molecular formula C9H9ClOS and a molecular weight of 200.69 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride. InChIKey: NDXZYCKYJSHECJ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClOS |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride |
| InChIKey | NDXZYCKYJSHECJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(S2)C(=O)Cl |
Computed by PubChem (NCBI)