Products 65361-26-4

CAS 65361-26-4 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1-benzothiophene-2-carbonyl chloride, 95%, 4,5,6,7-Tetrahydrobenzo(b)thiophene-2-carbonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride (CAS 65361-26-4) is a chemical compound with the molecular formula C9H9ClOS and a molecular weight of 200.69 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride. InChIKey: NDXZYCKYJSHECJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClOS
Molecular weight200.69 g/mol
IUPAC name4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride
InChIKeyNDXZYCKYJSHECJ-UHFFFAOYSA-N
SMILESC1CCC2=C(C1)C=C(S2)C(=O)Cl

Computed by PubChem (NCBI)