Products 887092-71-9

CAS 887092-71-9 is the registry number for S-2-Chlorobenzyl ethanethioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.

Structural formula: {0} (CAS {1})

S-[(2-chlorophenyl)methyl] ethanethioate (CAS 887092-71-9) is a chemical compound with the molecular formula C9H9ClOS and a molecular weight of 200.69 g/mol. IUPAC name: S-[(2-chlorophenyl)methyl] ethanethioate. InChIKey: CYOYOMBXWRTWFY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClOS
Molecular weight200.69 g/mol
IUPAC nameS-[(2-chlorophenyl)methyl] ethanethioate
InChIKeyCYOYOMBXWRTWFY-UHFFFAOYSA-N
SMILESCC(=O)SCC1=CC=CC=C1Cl

Computed by PubChem (NCBI)