Products 955126-39-3
CAS 955126-39-3 appears in our catalog under these names: (5-Chlorothiophen-2-yl)(cyclobutyl)methanone, 98%, (5-Chlorothiophen-2-yl)(cyclobutyl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 5g.
(5-chlorothiophen-2-yl)-cyclobutylmethanone (CAS 955126-39-3) is a chemical compound with the molecular formula C9H9ClOS and a molecular weight of 200.69 g/mol. IUPAC name: (5-chlorothiophen-2-yl)-cyclobutylmethanone. InChIKey: QFGINQSECJLBIO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClOS |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | (5-chlorothiophen-2-yl)-cyclobutylmethanone |
| InChIKey | QFGINQSECJLBIO-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)C2=CC=C(S2)Cl |
Computed by PubChem (NCBI)