Products 35568-36-6
CAS 35568-36-6 is the registry number for (R)-4-Amino-3-phenylbutanoicacid (enantiomer of deschlorobaclofen). Offered by: TRC. Available pack sizes: 100mg.
(3R)-4-amino-3-phenylbutanoic acid (CAS 35568-36-6) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3R)-4-amino-3-phenylbutanoic acid. InChIKey: DAFOCGYVTAOKAJ-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (3R)-4-amino-3-phenylbutanoic acid |
| InChIKey | DAFOCGYVTAOKAJ-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CC(=O)O)CN |
Computed by PubChem (NCBI)
Synonyms:
R-(-)-beta-Phenyl-gaba, 4-Amino-3-phenylbutyric acid, (R)-, L-beta-Phenyl-gamma-aminobutyric acid, Benzenepropanoic acid, beta-(aminomethyl)-, (betaR)-, R-(-)-.BETA.-PHENYL-GABA, L-.BETA.-PHENYL-.GAMMA.-AMINOBUTYRIC ACID, BENZENEPROPANOIC ACID, .BETA.-(AMINOMETHYL)-, (.BETA.R)-, (3R)-4-amino-3-phenylbutanoic acid, (R)-4-Amino-3-phenylbutanoicacid (enantiomer of deschlorobaclofen), 4-Amino-3-phenyl-butyric acid