Products 62596-63-8
CAS 62596-63-8 is the registry number for (S)-4-Amino-3-phenylbutanoicacid. Offered by: Biosynth. Available pack sizes: 0,05g, 0,025g, 0,1g.
(3S)-4-amino-3-phenylbutanoic acid (CAS 62596-63-8) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3S)-4-amino-3-phenylbutanoic acid. InChIKey: DAFOCGYVTAOKAJ-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (3S)-4-amino-3-phenylbutanoic acid |
| InChIKey | DAFOCGYVTAOKAJ-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CC(=O)O)CN |
Computed by PubChem (NCBI)
Synonyms:
(3S)-4-amino-3-phenylbutanoic acid, (+)-4-Amino-3-phenylbutanoic acid, 4-Amino-3-phenylbutyric acid, (S)-, (S)-4-Amino-3-phenylbutanoicacid, Benzenepropanoic acid, beta-(aminomethyl)-, (betaS)-, Fenigam, (S)-4-amino-3-phenylbutyric acid, BENZENEPROPANOIC ACID, .BETA.-(AMINOMETHYL)-, (.BETA.S)-