Products 35573-36-5

CAS 35573-36-5 is the registry number for Ethyl 4-methoxybenzylcarbamate 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl N-[(4-methoxyphenyl)methyl]carbamate (CAS 35573-36-5) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: ethyl N-[(4-methoxyphenyl)methyl]carbamate. InChIKey: MCQWOCBABOZJSN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO3
Molecular weight209.24 g/mol
IUPAC nameethyl N-[(4-methoxyphenyl)methyl]carbamate
InChIKeyMCQWOCBABOZJSN-UHFFFAOYSA-N
SMILESCCOC(=O)NCC1=CC=C(C=C1)OC

Computed by PubChem (NCBI)