CAS 35581-10-3 appears in our catalog under these names: 2-Amino-6-methoxy-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid, 97%, 2-Amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-amino-6-methoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid (CAS 35581-10-3) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 2-amino-6-methoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid. InChIKey: RTQYWHRDCDMIRH-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-amino-6-methoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
| InChIKey | RTQYWHRDCDMIRH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(CC2)(C(=O)O)N)C=C1 |
Computed by PubChem (NCBI)