CAS 356570-11-1 is the registry number for 5-(2-Chlorophenyl)thiophene-2-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 10g.
5-(2-chlorophenyl)thiophene-2-carbaldehyde (CAS 356570-11-1) is a chemical compound with the molecular formula C11H7ClOS and a molecular weight of 222.69 g/mol. IUPAC name: 5-(2-chlorophenyl)thiophene-2-carbaldehyde. InChIKey: LOEKFPAEXOYFGC-UHFFFAOYSA-N.
| Molecular formula | C11H7ClOS |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | 5-(2-chlorophenyl)thiophene-2-carbaldehyde |
| InChIKey | LOEKFPAEXOYFGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(S2)C=O)Cl |
Computed by PubChem (NCBI)