CAS 51081-72-2 appears in our catalog under these names: 5-(3-Chlorophenyl)thiophene-2-carbaldehyde, 98%, 5-(3-Chloro-phenyl)-thiophene-2-carbaldehyde. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 1g.
5-(3-chlorophenyl)thiophene-2-carbaldehyde (CAS 51081-72-2) is a chemical compound with the molecular formula C11H7ClOS and a molecular weight of 222.69 g/mol. IUPAC name: 5-(3-chlorophenyl)thiophene-2-carbaldehyde. InChIKey: DNIBJTALGPZHEB-UHFFFAOYSA-N.
| Molecular formula | C11H7ClOS |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | 5-(3-chlorophenyl)thiophene-2-carbaldehyde |
| InChIKey | DNIBJTALGPZHEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(S2)C=O |
Computed by PubChem (NCBI)