Products 3566-94-7
CAS 3566-94-7 is the registry number for Flazo Orange. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(5-chloro-2-hydroxyphenyl)diazenyl]naphthalen-2-ol (CAS 3566-94-7) is a chemical compound with the molecular formula C16H11ClN2O2 and a molecular weight of 298.72 g/mol. IUPAC name: 1-[(5-chloro-2-hydroxyphenyl)diazenyl]naphthalen-2-ol. InChIKey: HQKOBNMULFASAN-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2O2 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | 1-[(5-chloro-2-hydroxyphenyl)diazenyl]naphthalen-2-ol |
| InChIKey | HQKOBNMULFASAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N=NC3=C(C=CC(=C3)Cl)O)O |
Computed by PubChem (NCBI)