CAS 10440-42-3 appears in our catalog under these names: Glafenic Acid, Glafenic Acid, 2-((7-Chloroquinolin-4-yl)amino)benzoic acid, ≥95%, ≥95%. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 500mg, 100mg, 1g, 250mg, 50mg.
2-[(7-chloroquinolin-4-yl)amino]benzoic acid (CAS 10440-42-3) is a chemical compound with the molecular formula C16H11ClN2O2 and a molecular weight of 298.72 g/mol. IUPAC name: 2-[(7-chloroquinolin-4-yl)amino]benzoic acid. InChIKey: HTKGKUISLUERQX-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2O2 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | 2-[(7-chloroquinolin-4-yl)amino]benzoic acid |
| InChIKey | HTKGKUISLUERQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=C3C=CC(=CC3=NC=C2)Cl |
Computed by PubChem (NCBI)