Products 588696-83-7

CAS 588696-83-7 is the registry number for 7-Chloro-8-methyl-2-pyridin-3-ylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

7-chloro-8-methyl-2-pyridin-3-ylquinoline-4-carboxylic acid (CAS 588696-83-7) is a chemical compound with the molecular formula C16H11ClN2O2 and a molecular weight of 298.72 g/mol. IUPAC name: 7-chloro-8-methyl-2-pyridin-3-ylquinoline-4-carboxylic acid. InChIKey: GJRLWOOMYJFTMN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11ClN2O2
Molecular weight298.72 g/mol
IUPAC name7-chloro-8-methyl-2-pyridin-3-ylquinoline-4-carboxylic acid
InChIKeyGJRLWOOMYJFTMN-UHFFFAOYSA-N
SMILESCC1=C(C=CC2=C1N=C(C=C2C(=O)O)C3=CN=CC=C3)Cl

Computed by PubChem (NCBI)