CAS 172476-18-5 appears in our catalog under these names: 5-((7-Chloroquinolin-4-yl)amino)-2-hydroxybenzaldehyde, 97%, 5-((7-Chloro-4-quinolinyl)amino)-2-hydroxybenzaldehyde. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1mg, 2,5mg, 25mg.
5-[(7-chloroquinolin-4-yl)amino]-2-hydroxybenzaldehyde (CAS 172476-18-5) is a chemical compound with the molecular formula C16H11ClN2O2 and a molecular weight of 298.72 g/mol. IUPAC name: 5-[(7-chloroquinolin-4-yl)amino]-2-hydroxybenzaldehyde. InChIKey: AZKNHPGTHFOACE-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN2O2 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | 5-[(7-chloroquinolin-4-yl)amino]-2-hydroxybenzaldehyde |
| InChIKey | AZKNHPGTHFOACE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=C3C=CC(=CC3=NC=C2)Cl)C=O)O |
Computed by PubChem (NCBI)