Products 35661-51-9
CAS 35661-51-9 appears in our catalog under these names: 9-Fluorenylmethyl Carbazate, 9–Fluorenylmethyl carbazate, 9-Fluorenylmethyl carbazate, 99.87%, 9-Fluorenylmethyl carbazate, 97%, 9-Fluorenylmethyl Carbazate, >98.0%(HPLC)(T). Offered by: TRC, GLPBio, MedChemExpress, Fluorochem, TCI. Available pack sizes: 5g, 100mg, 250mg, 10 g, 5 g, 10mM/1mL, 1 g, 1g.
9H-fluoren-9-ylmethyl N-aminocarbamate (CAS 35661-51-9) is a chemical compound with the molecular formula C15H14N2O2 and a molecular weight of 254.28 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-aminocarbamate. InChIKey: YGCGPEUVGHDMLO-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O2 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-aminocarbamate |
| InChIKey | YGCGPEUVGHDMLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NN |
Computed by PubChem (NCBI)
Synonyms:
9-Fluorenylmethyl carbazate, Fmoc-hydrazine, 9-Fluorenylmethyl chloroformate hydrazine, Fmoc-hydrazide, (9H-Fluoren-9-yl)methyl hydrazinecarboxylate, 9H-fluoren-9-ylmethyl N-aminocarbamate, Hydrazinecarboxylic acid, 9H-fluoren-9-ylmethyl ester, 9h-fluoren-9-ylmethyl hydrazinecarboxylate, Fmoc hydrazine, Fmoc-NHNH2