Products 35691-30-6

CAS 35691-30-6 is the registry number for Diethyl pyridazine-1,2(3H,6H)-dicarboxylate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 3,6-dihydropyridazine-1,2-dicarboxylate (CAS 35691-30-6) is a chemical compound with the molecular formula C10H16N2O4 and a molecular weight of 228.24 g/mol. IUPAC name: diethyl 3,6-dihydropyridazine-1,2-dicarboxylate. InChIKey: QJTXVDDNYXLLDA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16N2O4
Molecular weight228.24 g/mol
IUPAC namediethyl 3,6-dihydropyridazine-1,2-dicarboxylate
InChIKeyQJTXVDDNYXLLDA-UHFFFAOYSA-N
SMILESCCOC(=O)N1CC=CCN1C(=O)OCC

Computed by PubChem (NCBI)