Products 357441-99-7
CAS 357441-99-7 is the registry number for N.41. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-3-(4-hydroxyanilino)-1-pyridin-3-ylbut-2-en-1-one (CAS 357441-99-7) is a chemical compound with the molecular formula C15H14N2O2 and a molecular weight of 254.28 g/mol. IUPAC name: (Z)-3-(4-hydroxyanilino)-1-pyridin-3-ylbut-2-en-1-one. InChIKey: YJVDMNPGQGXXGJ-LUAWRHEFSA-N.
| Molecular formula | C15H14N2O2 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (Z)-3-(4-hydroxyanilino)-1-pyridin-3-ylbut-2-en-1-one |
| InChIKey | YJVDMNPGQGXXGJ-LUAWRHEFSA-N |
| SMILES | C/C(=C/C(=O)C1=CN=CC=C1)/NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)