Products 357637-15-1
CAS 357637-15-1 appears in our catalog under these names: 5–Hydroxy–2–(2–(2–hydroxyphenyl)ethyl)chromone, 5-Hydroxy-2-[2-(2-hydroxyphenyl)ethyl]chromone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5 mg, 1 mg.
5-hydroxy-2-[2-(2-hydroxyphenyl)ethyl]chromen-4-one (CAS 357637-15-1) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 5-hydroxy-2-[2-(2-hydroxyphenyl)ethyl]chromen-4-one. InChIKey: VJJIYNCAKZLESG-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 5-hydroxy-2-[2-(2-hydroxyphenyl)ethyl]chromen-4-one |
| InChIKey | VJJIYNCAKZLESG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC2=CC(=O)C3=C(C=CC=C3O2)O)O |
Computed by PubChem (NCBI)