CAS 35850-08-9 appears in our catalog under these names: 5-Bromo-2-methyl-2,3-dihydrobenzofuran-7-carboxylic acid, 97%, 97%, 5-Bromo-2-methyl-2,3-dihydrobenzofuran-7-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 35850-08-9) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: JKACRIPAJIUBIR-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | JKACRIPAJIUBIR-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(O1)C(=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)