CAS 35974-37-9 appears in our catalog under these names: 2-(Pyridin-2-yloxy)phenol, 95%, o-(2-Pyridyloxy)phenol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-pyridin-2-yloxyphenol (CAS 35974-37-9) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 2-pyridin-2-yloxyphenol. InChIKey: XWBHCJMXMDVYLP-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-pyridin-2-yloxyphenol |
| InChIKey | XWBHCJMXMDVYLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)O)OC2=CC=CC=N2 |
Computed by PubChem (NCBI)