Products 361337-08-8
CAS 361337-08-8 appears in our catalog under these names: Carbamic acid, (3-bromophenyl)-, phenylmethyl ester, 98%, Benzyl (3-bromophenyl)carbamate, 97%, Benzyl (3-bromophenyl)carbamate, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g.
Benzyl N-(3-bromophenyl)carbamate (CAS 361337-08-8) is a chemical compound with the molecular formula C14H12BrNO2 and a molecular weight of 306.15 g/mol. IUPAC name: benzyl N-(3-bromophenyl)carbamate. InChIKey: RKTXDGRJOLJFAG-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2 |
|---|---|
| Molecular weight | 306.15 g/mol |
| IUPAC name | benzyl N-(3-bromophenyl)carbamate |
| InChIKey | RKTXDGRJOLJFAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)