Products 36151-01-6
CAS 36151-01-6 appears in our catalog under these names: Blumenol B, 7,8-Dihydrovomifoliol, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
(4S)-4-hydroxy-4-(3-hydroxybutyl)-3,5,5-trimethylcyclohex-2-en-1-one (CAS 36151-01-6) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: (4S)-4-hydroxy-4-(3-hydroxybutyl)-3,5,5-trimethylcyclohex-2-en-1-one. InChIKey: CWOFGGNDZOPNFG-JLOHTSLTSA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | (4S)-4-hydroxy-4-(3-hydroxybutyl)-3,5,5-trimethylcyclohex-2-en-1-one |
| InChIKey | CWOFGGNDZOPNFG-JLOHTSLTSA-N |
| SMILES | CC1=CC(=O)CC([C@]1(CCC(C)O)O)(C)C |
Computed by PubChem (NCBI)