Products 1389395-04-3
CAS 1389395-04-3 is the registry number for Methyl (2E)-3-ethyl-5-((2R,3S)-3-ethyl-3-methyl-2-oxiranyl)-2-pentenoate. Offered by: TRC. Available pack sizes: 500mg.
Methyl (E)-3-ethyl-5-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]pent-2-enoate (CAS 1389395-04-3) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: methyl (E)-3-ethyl-5-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]pent-2-enoate. InChIKey: CMTOIURTFSRJQY-FCSPZMLESA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | methyl (E)-3-ethyl-5-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]pent-2-enoate |
| InChIKey | CMTOIURTFSRJQY-FCSPZMLESA-N |
| SMILES | CC/C(=C\C(=O)OC)/CC[C@@H]1[C@](O1)(C)CC |
Computed by PubChem (NCBI)