CAS 4427-97-8 appears in our catalog under these names: Dicyclohexyl Carbonate, Dicyclohexyl carbonate, 95%, 95%, Dicyclohexyl carbonate, 95%. Offered by: TRC, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 100g, 10 g, 5 g, 1 g.
Dicyclohexyl carbonate (CAS 4427-97-8) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: dicyclohexyl carbonate. InChIKey: FYIBPWZEZWVDQB-UHFFFAOYSA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | dicyclohexyl carbonate |
| InChIKey | FYIBPWZEZWVDQB-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC(=O)OC2CCCCC2 |
Computed by PubChem (NCBI)