CAS 2766347-60-6 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3-dioxolan-2-yl)cyclohexan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)cyclohexan-1-one (CAS 2766347-60-6) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)cyclohexan-1-one. InChIKey: QDCOCKTWAMNOMJ-UHFFFAOYSA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)cyclohexan-1-one |
| InChIKey | QDCOCKTWAMNOMJ-UHFFFAOYSA-N |
| SMILES | CC1(C(OC(O1)C2CCC(=O)CC2)(C)C)C |
Computed by PubChem (NCBI)