Products 362027-09-6
CAS 362027-09-6 is the registry number for 6-Bromo-7-methoxy-3,4-dihydronaphthalen-1(2H)-one, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
6-bromo-7-methoxy-3,4-dihydro-2H-naphthalen-1-one (CAS 362027-09-6) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 6-bromo-7-methoxy-3,4-dihydro-2H-naphthalen-1-one. InChIKey: AGDXYXYEJYKZQK-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 6-bromo-7-methoxy-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | AGDXYXYEJYKZQK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CCCC(=O)C2=C1)Br |
Computed by PubChem (NCBI)