CAS 36246-11-4 is the registry number for 4-(5-Methoxy-1h-indol-3-yl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(5-methoxy-1H-indol-3-yl)-1,3-thiazol-2-amine (CAS 36246-11-4) is a chemical compound with the molecular formula C12H11N3OS and a molecular weight of 245.30 g/mol. IUPAC name: 4-(5-methoxy-1H-indol-3-yl)-1,3-thiazol-2-amine. InChIKey: DSMFLFNPUPWNQN-UHFFFAOYSA-N.
| Molecular formula | C12H11N3OS |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 4-(5-methoxy-1H-indol-3-yl)-1,3-thiazol-2-amine |
| InChIKey | DSMFLFNPUPWNQN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C2C3=CSC(=N3)N |
Computed by PubChem (NCBI)