CAS 871673-04-0 appears in our catalog under these names: 2-(5-(2-Amino-1,3-thiazol-4-yl)-2-methoxyphenyl)acetonitrile, 95%, 2-(5-(2-Amino-1,3-thiazol-4-yl)-2-methoxyphenyl)acetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[5-(2-amino-1,3-thiazol-4-yl)-2-methoxyphenyl]acetonitrile (CAS 871673-04-0) is a chemical compound with the molecular formula C12H11N3OS and a molecular weight of 245.30 g/mol. IUPAC name: 2-[5-(2-amino-1,3-thiazol-4-yl)-2-methoxyphenyl]acetonitrile. InChIKey: UWILBORHCWBAPY-UHFFFAOYSA-N.
| Molecular formula | C12H11N3OS |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 2-[5-(2-amino-1,3-thiazol-4-yl)-2-methoxyphenyl]acetonitrile |
| InChIKey | UWILBORHCWBAPY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CSC(=N2)N)CC#N |
Computed by PubChem (NCBI)