CAS 91397-03-4 is the registry number for 4-Isothiocyanato-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-isothiocyanato-1,5-dimethyl-2-phenylpyrazol-3-one (CAS 91397-03-4) is a chemical compound with the molecular formula C12H11N3OS and a molecular weight of 245.30 g/mol. IUPAC name: 4-isothiocyanato-1,5-dimethyl-2-phenylpyrazol-3-one. InChIKey: GJYUDKCCGFCEBA-UHFFFAOYSA-N.
| Molecular formula | C12H11N3OS |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 4-isothiocyanato-1,5-dimethyl-2-phenylpyrazol-3-one |
| InChIKey | GJYUDKCCGFCEBA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N=C=S |
Computed by PubChem (NCBI)