Products 91397-03-4

CAS 91397-03-4 is the registry number for 4-Isothiocyanato-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-isothiocyanato-1,5-dimethyl-2-phenylpyrazol-3-one (CAS 91397-03-4) is a chemical compound with the molecular formula C12H11N3OS and a molecular weight of 245.30 g/mol. IUPAC name: 4-isothiocyanato-1,5-dimethyl-2-phenylpyrazol-3-one. InChIKey: GJYUDKCCGFCEBA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3OS
Molecular weight245.30 g/mol
IUPAC name4-isothiocyanato-1,5-dimethyl-2-phenylpyrazol-3-one
InChIKeyGJYUDKCCGFCEBA-UHFFFAOYSA-N
SMILESCC1=C(C(=O)N(N1C)C2=CC=CC=C2)N=C=S

Computed by PubChem (NCBI)