Products 556042-48-9
CAS 556042-48-9 is the registry number for N-(5-Cyclopropyl-1,3,4-thiadiazol-2-yl)benzamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)benzamide (CAS 556042-48-9) is a chemical compound with the molecular formula C12H11N3OS and a molecular weight of 245.30 g/mol. IUPAC name: N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)benzamide. InChIKey: OEPZYXYBQGESTK-UHFFFAOYSA-N.
| Molecular formula | C12H11N3OS |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)benzamide |
| InChIKey | OEPZYXYBQGESTK-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN=C(S2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)