CAS 362495-75-8 is the registry number for Aziridine, 1–((4–methylphenyl)sulfonyl)–2–(phenylmethyl)–, (2R)–. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 50mg.
(2R)-2-benzyl-1-(4-methylphenyl)sulfonylaziridine (CAS 362495-75-8) is a chemical compound with the molecular formula C16H17NO2S and a molecular weight of 287.4 g/mol. IUPAC name: (2R)-2-benzyl-1-(4-methylphenyl)sulfonylaziridine. InChIKey: ISURUORMAKCTFF-LDCVWXEPSA-N.
| Molecular formula | C16H17NO2S |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | (2R)-2-benzyl-1-(4-methylphenyl)sulfonylaziridine |
| InChIKey | ISURUORMAKCTFF-LDCVWXEPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C[C@H]2CC3=CC=CC=C3 |
Computed by PubChem (NCBI)