Products 362529-03-1
CAS 362529-03-1 appears in our catalog under these names: 5-[4-(Bromomethyl)phenyl]-3-methyl-1,2,4-oxadiazole, 95%, 5-(4-(Bromomethyl)phenyl)-3-methyl-1,2,4-oxadiazole, 98+%, 5-[4-(Bromomethyl)phenyl]-3-methyl-1,2,4-oxadiazole, 95% , 5-[4-(BROMOMETHYL)PHENYL]-3-METHYL-1,2,4-OXADIAZOLE, 98%, 98%. Offered by: Combi-blocks, AmBeed, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
5-[4-(bromomethyl)phenyl]-3-methyl-1,2,4-oxadiazole (CAS 362529-03-1) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 5-[4-(bromomethyl)phenyl]-3-methyl-1,2,4-oxadiazole. InChIKey: RWTXHMRWDVQEOV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 5-[4-(bromomethyl)phenyl]-3-methyl-1,2,4-oxadiazole |
| InChIKey | RWTXHMRWDVQEOV-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)