Products 3627-45-0
CAS 3627-45-0 appears in our catalog under these names: 4-Phenyl-4-piperidine Carboxylic Acid, 4–PHENYL–4–PIPERIDINE CARBOXYLIC ACID, 4-Phenylpiridine-4-carboxylic acid. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 2,5g, 1g, 5g, 250mg, 100mg, 500mg.
4-phenylpiperidine-4-carboxylic acid (CAS 3627-45-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 4-phenylpiperidine-4-carboxylic acid. InChIKey: DZZGGKPKWGPNJA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 4-phenylpiperidine-4-carboxylic acid |
| InChIKey | DZZGGKPKWGPNJA-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Phenylpiperidine-4-carboxylic acid, compound with toluene-p-sulphonic acid, 4-Phenylpiperidine-4-carboxylic acid, 4-Phenyl-4-piperidine carboxylic acid, 4-Phenyl-4-piperidinecarboxylic acid, 4-Piperidinecarboxylic acid, 4-phenyl-, 4-phenyl-piperidine-4-carboxylic acid, Norpethidinic acid, 4-Piperidinecarboxylicacid, 4-phenyl-, Normeperidinic acid, N-Demthylmeperidinic acid