CAS 36340-49-5 appears in our catalog under these names: Ionone Impurity 2, (E)-4-(2,2,6-Trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)but-3-en-2-one 95%, (E)-4-(2,2,6-Trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)but-3-en-2-one, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)but-3-en-2-one (CAS 36340-49-5) is a chemical compound with the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. IUPAC name: 4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)but-3-en-2-one. InChIKey: ZTJZJYUGOJYHCU-UHFFFAOYSA-N.
| Molecular formula | C13H20O2 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)but-3-en-2-one |
| InChIKey | ZTJZJYUGOJYHCU-UHFFFAOYSA-N |
| SMILES | CC(=O)C=CC12C(CCCC1(O2)C)(C)C |
Computed by PubChem (NCBI)