Products 363620-21-7
CAS 363620-21-7 appears in our catalog under these names: 6-Chloro-3-ethoxy-2-fluoro-benzaldehyde, 95%, 6-Chloro-3-ethoxy-2-fluorobenzaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
6-chloro-3-ethoxy-2-fluorobenzaldehyde (CAS 363620-21-7) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 6-chloro-3-ethoxy-2-fluorobenzaldehyde. InChIKey: FGYJEQRISUNQBH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 6-chloro-3-ethoxy-2-fluorobenzaldehyde |
| InChIKey | FGYJEQRISUNQBH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)Cl)C=O)F |
Computed by PubChem (NCBI)