Products 364046-14-0
CAS 364046-14-0 is the registry number for 2-(2-Methoxy-3-nitropyridin-4-yl)-N,N-dimethylethen-1-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine (CAS 364046-14-0) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: 2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine. InChIKey: JUMZKSSQQBQUDE-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine |
| InChIKey | JUMZKSSQQBQUDE-UHFFFAOYSA-N |
| SMILES | CN(C)C=CC1=C(C(=NC=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)