Products 36431-52-4
CAS 36431-52-4 is the registry number for LL-Z1220. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1R,2R,4R,7R)-3,8-dioxatricyclo[5.1.0.02,4]oct-5-en-5-yl]pyran-4-one (CAS 36431-52-4) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 2-[(1R,2R,4R,7R)-3,8-dioxatricyclo[5.1.0.02,4]oct-5-en-5-yl]pyran-4-one. InChIKey: WWHMQTDCCWMKQY-GWOFURMSSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-[(1R,2R,4R,7R)-3,8-dioxatricyclo[5.1.0.02,4]oct-5-en-5-yl]pyran-4-one |
| InChIKey | WWHMQTDCCWMKQY-GWOFURMSSA-N |
| SMILES | C1=COC(=CC1=O)C2=C[C@@H]3[C@@H](O3)[C@H]4[C@@H]2O4 |
Computed by PubChem (NCBI)