Products 364621-96-5

CAS 364621-96-5 is the registry number for Methyl 5-((2-chlorophenoxy)methyl)-2-furoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-[(2-chlorophenoxy)methyl]furan-2-carboxylate (CAS 364621-96-5) is a chemical compound with the molecular formula C13H11ClO4 and a molecular weight of 266.67 g/mol. IUPAC name: methyl 5-[(2-chlorophenoxy)methyl]furan-2-carboxylate. InChIKey: RLIRFBBJPNJRGU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClO4
Molecular weight266.67 g/mol
IUPAC namemethyl 5-[(2-chlorophenoxy)methyl]furan-2-carboxylate
InChIKeyRLIRFBBJPNJRGU-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(O1)COC2=CC=CC=C2Cl

Computed by PubChem (NCBI)