CAS 406470-68-6 is the registry number for Methyl 5-((4-chlorophenoxy)methyl)-2-furoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 5-[(4-chlorophenoxy)methyl]furan-2-carboxylate (CAS 406470-68-6) is a chemical compound with the molecular formula C13H11ClO4 and a molecular weight of 266.67 g/mol. IUPAC name: methyl 5-[(4-chlorophenoxy)methyl]furan-2-carboxylate. InChIKey: LANUDODLVMMCPH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO4 |
|---|---|
| Molecular weight | 266.67 g/mol |
| IUPAC name | methyl 5-[(4-chlorophenoxy)methyl]furan-2-carboxylate |
| InChIKey | LANUDODLVMMCPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(O1)COC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)