CAS 406470-55-1 appears in our catalog under these names: 5-((4-Chloro-3-methylphenoxy)methyl)furan-2-carboxylic acid, 95+%, 5-(4-Chloro-3-methylphenoxymethyl)furan-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxylic acid (CAS 406470-55-1) is a chemical compound with the molecular formula C13H11ClO4 and a molecular weight of 266.67 g/mol. IUPAC name: 5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxylic acid. InChIKey: QTABSYVYXVDOQN-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO4 |
|---|---|
| Molecular weight | 266.67 g/mol |
| IUPAC name | 5-[(4-chloro-3-methylphenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | QTABSYVYXVDOQN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC2=CC=C(O2)C(=O)O)Cl |
Computed by PubChem (NCBI)